C11H5Cl2N3O5 — CID 63952807
1-(2,6-dichloro-4-nitrophenyl)-4-oxopyridazine-3-carboxylic acid (PubChem CID 63952807) has the molecular formula C11H5Cl2N3O5 and a molecular weight of 330.08 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenyl)-4-oxopyridazine-3-carboxylic acid.
| Compound Name | 1-(2,6-dichloro-4-nitrophenyl)-4-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 63952807 |
| Molecular Formula | C11H5Cl2N3O5 |
| Molecular Weight | 330.08 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | 1-(2,6-dichloro-4-nitrophenyl)-4-oxopyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1nn(-c2c(Cl)cc([N+](=O)[O-])cc2Cl)ccc1=O |
| InChI | InChI=1S/C11H5Cl2N3O5/c12-6-3-5(16(20)21)4-7(13)10(6)15-2-1-8(17)9(14-15)11(18)19/h1-4H,(H,18,19) |
| InChIKey | UKDQKJOGRSIMJF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|