C15H15Cl2N5O3 — CID 119415865
1,4-diazepan-1-yl-[1-(2,6-dichloro-4-nitrophenyl)pyrazol-3-yl]methanone (PubChem CID 119415865) has the molecular formula C15H15Cl2N5O3 and a molecular weight of 384.22 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[1-(2,6-dichloro-4-nitrophenyl)pyrazol-3-yl]methanone.
| Compound Name | 1,4-diazepan-1-yl-[1-(2,6-dichloro-4-nitrophenyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 119415865 |
| Molecular Formula | C15H15Cl2N5O3 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 1,4-diazepan-1-yl-[1-(2,6-dichloro-4-nitrophenyl)pyrazol-3-yl]methanone |
| SMILES | O=C(c1ccn(-c2c(Cl)cc([N+](=O)[O-])cc2Cl)n1)N1CCCNCC1 |
| InChI | InChI=1S/C15H15Cl2N5O3/c16-11-8-10(22(24)25)9-12(17)14(11)21-6-2-13(19-21)15(23)20-5-1-3-18-4-7-20/h2,6,8-9,18H,1,3-5,7H2 |
| InChIKey | BRVIUIXJLZUCIY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|