C16H17Cl2N5O3 — CID 120573386
1-(2,6-dichloro-4-nitrophenyl)-N-(2-methylpiperidin-3-yl)pyrazole-3-carboxamide (PubChem CID 120573386) has the molecular formula C16H17Cl2N5O3 and a molecular weight of 398.25 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenyl)-N-(2-methylpiperidin-3-yl)pyrazole-3-carboxamide.
| Compound Name | 1-(2,6-dichloro-4-nitrophenyl)-N-(2-methylpiperidin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 120573386 |
| Molecular Formula | C16H17Cl2N5O3 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 1-(2,6-dichloro-4-nitrophenyl)-N-(2-methylpiperidin-3-yl)pyrazole-3-carboxamide |
| SMILES | CC1NCCCC1NC(=O)c1ccn(-c2c(Cl)cc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C16H17Cl2N5O3/c1-9-13(3-2-5-19-9)20-16(24)14-4-6-22(21-14)15-11(17)7-10(23(25)26)8-12(15)18/h4,6-9,13,19H,2-3,5H2,1H3,(H,20,24) |
| InChIKey | YJFDGNQWKXYYAV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|