C15H16Cl3N5O3 — CID 119471355
[1-(2,6-dichloro-4-nitrophenyl)pyrazol-3-yl]-(2-methylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 119471355) has the molecular formula C15H16Cl3N5O3 and a molecular weight of 420.68 g/mol. Its IUPAC name is [1-(2,6-dichloro-4-nitrophenyl)pyrazol-3-yl]-(2-methylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | [1-(2,6-dichloro-4-nitrophenyl)pyrazol-3-yl]-(2-methylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119471355 |
| Molecular Formula | C15H16Cl3N5O3 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | [1-(2,6-dichloro-4-nitrophenyl)pyrazol-3-yl]-(2-methylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CC1CNCCN1C(=O)c1ccn(-c2c(Cl)cc([N+](=O)[O-])cc2Cl)n1.Cl |
| InChI | InChI=1S/C15H15Cl2N5O3.ClH/c1-9-8-18-3-5-20(9)15(23)13-2-4-21(19-13)14-11(16)6-10(22(24)25)7-12(14)17;/h2,4,6-7,9,18H,3,5,8H2,1H3;1H |
| InChIKey | IOZPZPUEOJZMDW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|