C13H18ClN3O5S — CID 119473578
(2-methylpiperazin-1-yl)-(3-methylsulfonyl-5-nitrophenyl)methanone;hydrochloride (PubChem CID 119473578) has the molecular formula C13H18ClN3O5S and a molecular weight of 363.82 g/mol. Its IUPAC name is (2-methylpiperazin-1-yl)-(3-methylsulfonyl-5-nitrophenyl)methanone;hydrochloride.
| Compound Name | (2-methylpiperazin-1-yl)-(3-methylsulfonyl-5-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119473578 |
| Molecular Formula | C13H18ClN3O5S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | (2-methylpiperazin-1-yl)-(3-methylsulfonyl-5-nitrophenyl)methanone;hydrochloride |
| SMILES | CC1CNCCN1C(=O)c1cc([N+](=O)[O-])cc(S(C)(=O)=O)c1.Cl |
| InChI | InChI=1S/C13H17N3O5S.ClH/c1-9-8-14-3-4-15(9)13(17)10-5-11(16(18)19)7-12(6-10)22(2,20)21;/h5-7,9,14H,3-4,8H2,1-2H3;1H |
| InChIKey | IXIQXTUNBUORRX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|