C12H15ClFN3O3 — CID 119472828
(2-fluoro-4-nitrophenyl)-(2-methylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 119472828) has the molecular formula C12H15ClFN3O3 and a molecular weight of 303.72 g/mol. Its IUPAC name is (2-fluoro-4-nitrophenyl)-(2-methylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (2-fluoro-4-nitrophenyl)-(2-methylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119472828 |
| Molecular Formula | C12H15ClFN3O3 |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2-fluoro-4-nitrophenyl)-(2-methylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CC1CNCCN1C(=O)c1ccc([N+](=O)[O-])cc1F.Cl |
| InChI | InChI=1S/C12H14FN3O3.ClH/c1-8-7-14-4-5-15(8)12(17)10-3-2-9(16(18)19)6-11(10)13;/h2-3,6,8,14H,4-5,7H2,1H3;1H |
| InChIKey | JZGHJKQXJZXVFB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|