C14H16Cl3N5O3 — CID 119496642
N-(3-aminobutyl)-1-(2,6-dichloro-4-nitrophenyl)pyrazole-3-carboxamide;hydrochloride (PubChem CID 119496642) has the molecular formula C14H16Cl3N5O3 and a molecular weight of 408.67 g/mol. Its IUPAC name is N-(3-aminobutyl)-1-(2,6-dichloro-4-nitrophenyl)pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-1-(2,6-dichloro-4-nitrophenyl)pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119496642 |
| Molecular Formula | C14H16Cl3N5O3 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | N-(3-aminobutyl)-1-(2,6-dichloro-4-nitrophenyl)pyrazole-3-carboxamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)c1ccn(-c2c(Cl)cc([N+](=O)[O-])cc2Cl)n1.Cl |
| InChI | InChI=1S/C14H15Cl2N5O3.ClH/c1-8(17)2-4-18-14(22)12-3-5-20(19-12)13-10(15)6-9(21(23)24)7-11(13)16;/h3,5-8H,2,4,17H2,1H3,(H,18,22);1H |
| InChIKey | XOQWDSOALSGJEF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|