C13H16N6O3 — CID 120826695
N-[2-(methylamino)propyl]-1-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 120826695) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[2-(methylamino)propyl]-1-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | N-[2-(methylamino)propyl]-1-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 120826695 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-[2-(methylamino)propyl]-1-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | CNC(C)CNC(=O)c1cn(-c2cccc([N+](=O)[O-])c2)nn1 |
| InChI | InChI=1S/C13H16N6O3/c1-9(14-2)7-15-13(20)12-8-18(17-16-12)10-4-3-5-11(6-10)19(21)22/h3-6,8-9,14H,7H2,1-2H3,(H,15,20) |
| InChIKey | MOBRQFYGNIONRF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|