C18H19FN4O — CID 40660594
N-[(2S)-butan-2-yl]-1-(3-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 40660594) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-1-(3-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-[(2S)-butan-2-yl]-1-(3-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 40660594 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[(2S)-butan-2-yl]-1-(3-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | CC[C@H](C)NC(=O)c1cnn(-c2cccc(F)c2)c1-n1cccc1 |
| InChI | InChI=1S/C18H19FN4O/c1-3-13(2)21-17(24)16-12-20-23(15-8-6-7-14(19)11-15)18(16)22-9-4-5-10-22/h4-13H,3H2,1-2H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | MIXKEPLVEAIRMU-ZDUSSCGKSA-N |
| XLogP | 3.33 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |