C19H19FN4O — CID 20936868
N-cyclopentyl-1-(3-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 20936868) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is N-cyclopentyl-1-(3-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-cyclopentyl-1-(3-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 20936868 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-cyclopentyl-1-(3-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cnn(-c2cccc(F)c2)c1-n1cccc1 |
| InChI | InChI=1S/C19H19FN4O/c20-14-6-5-9-16(12-14)24-19(23-10-3-4-11-23)17(13-21-24)18(25)22-15-7-1-2-8-15/h3-6,9-13,15H,1-2,7-8H2,(H,22,25) |
| InChIKey | IXJPOQWZVWJWOW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |