C17H24N4O2 — CID 109380676
N-(3-hydroxy-2,2,4-trimethylpentyl)-1-phenyltriazole-4-carboxamide (PubChem CID 109380676) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-(3-hydroxy-2,2,4-trimethylpentyl)-1-phenyltriazole-4-carboxamide.
| Compound Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 109380676 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-1-phenyltriazole-4-carboxamide |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C17H24N4O2/c1-12(2)15(22)17(3,4)11-18-16(23)14-10-21(20-19-14)13-8-6-5-7-9-13/h5-10,12,15,22H,11H2,1-4H3,(H,18,23) |
| InChIKey | LVBWJLQDNDSKAU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |