C13H16N4O — CID 15048681
N,N-diethyl-1-phenyltriazole-4-carboxamide (PubChem CID 15048681) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is N,N-diethyl-1-phenyltriazole-4-carboxamide.
| Compound Name | N,N-diethyl-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 15048681 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | N,N-diethyl-1-phenyltriazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C13H16N4O/c1-3-16(4-2)13(18)12-10-17(15-14-12)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | AWLXZBUTVBSUEC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |