C17H20N6O — CID 56886594
N-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]-1-phenyltriazole-4-carboxamide (PubChem CID 56886594) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is N-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]-1-phenyltriazole-4-carboxamide.
| Compound Name | N-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 56886594 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N-methyl-N-[3-(1-methylpyrazol-4-yl)propyl]-1-phenyltriazole-4-carboxamide |
| SMILES | CN(CCCc1cnn(C)c1)C(=O)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C17H20N6O/c1-21(10-6-7-14-11-18-22(2)12-14)17(24)16-13-23(20-19-16)15-8-4-3-5-9-15/h3-5,8-9,11-13H,6-7,10H2,1-2H3 |
| InChIKey | IJLIWWJDTHUBFU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |