C14H15ClN4O3 — CID 119172878
4-[[1-(2-chlorophenyl)triazole-4-carbonyl]-methylamino]butanoic acid (PubChem CID 119172878) has the molecular formula C14H15ClN4O3 and a molecular weight of 322.75 g/mol. Its IUPAC name is 4-[[1-(2-chlorophenyl)triazole-4-carbonyl]-methylamino]butanoic acid.
| Compound Name | 4-[[1-(2-chlorophenyl)triazole-4-carbonyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119172878 |
| Molecular Formula | C14H15ClN4O3 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-[[1-(2-chlorophenyl)triazole-4-carbonyl]-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)c1cn(-c2ccccc2Cl)nn1 |
| InChI | InChI=1S/C14H15ClN4O3/c1-18(8-4-7-13(20)21)14(22)11-9-19(17-16-11)12-6-3-2-5-10(12)15/h2-3,5-6,9H,4,7-8H2,1H3,(H,20,21) |
| InChIKey | CNYDXFOGRSOODO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |