C13H12F3N5O3 — CID 119362390
3-[methyl-[1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carbonyl]amino]propanoic acid (PubChem CID 119362390) has the molecular formula C13H12F3N5O3 and a molecular weight of 343.27 g/mol. Its IUPAC name is 3-[methyl-[1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carbonyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119362390 |
| Molecular Formula | C13H12F3N5O3 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3-[methyl-[1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carbonyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)c1cn(-c2ccc(C(F)(F)F)cn2)nn1 |
| InChI | InChI=1S/C13H12F3N5O3/c1-20(5-4-11(22)23)12(24)9-7-21(19-18-9)10-3-2-8(6-17-10)13(14,15)16/h2-3,6-7H,4-5H2,1H3,(H,22,23) |
| InChIKey | RUUDTYJHMIPOHJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |