C14H15F3N6O — CID 119386131
N-piperidin-4-yl-1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carboxamide (PubChem CID 119386131) has the molecular formula C14H15F3N6O and a molecular weight of 340.31 g/mol. Its IUPAC name is N-piperidin-4-yl-1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carboxamide.
| Compound Name | N-piperidin-4-yl-1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119386131 |
| Molecular Formula | C14H15F3N6O |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-piperidin-4-yl-1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1cn(-c2ccc(C(F)(F)F)cn2)nn1 |
| InChI | InChI=1S/C14H15F3N6O/c15-14(16,17)9-1-2-12(19-7-9)23-8-11(21-22-23)13(24)20-10-3-5-18-6-4-10/h1-2,7-8,10,18H,3-6H2,(H,20,24) |
| InChIKey | VKKLXDHGUGPLFI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |