C14H14F3N5O3 — CID 119348310
3-methyl-2-[[1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carbonyl]amino]butanoic acid (PubChem CID 119348310) has the molecular formula C14H14F3N5O3 and a molecular weight of 357.29 g/mol. Its IUPAC name is 3-methyl-2-[[1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carbonyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119348310 |
| Molecular Formula | C14H14F3N5O3 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-methyl-2-[[1-[5-(trifluoromethyl)-2-pyridinyl]triazole-4-carbonyl]amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)c1cn(-c2ccc(C(F)(F)F)cn2)nn1)C(=O)O |
| InChI | InChI=1S/C14H14F3N5O3/c1-7(2)11(13(24)25)19-12(23)9-6-22(21-20-9)10-4-3-8(5-18-10)14(15,16)17/h3-7,11H,1-2H3,(H,19,23)(H,24,25) |
| InChIKey | VZJMMSHSMLLDTL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |