C13H21N5O3 — CID 63284811
4-[methyl-(1-piperidin-4-yltriazole-4-carbonyl)amino]butanoic acid (PubChem CID 63284811) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[methyl-(1-piperidin-4-yltriazole-4-carbonyl)amino]butanoic acid.
| Compound Name | 4-[methyl-(1-piperidin-4-yltriazole-4-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 63284811 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-[methyl-(1-piperidin-4-yltriazole-4-carbonyl)amino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C13H21N5O3/c1-17(8-2-3-12(19)20)13(21)11-9-18(16-15-11)10-4-6-14-7-5-10/h9-10,14H,2-8H2,1H3,(H,19,20) |
| InChIKey | JSYZTLRMMFZTTL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |