C12H21N5O3S — CID 79841941
N-methyl-N-(2-methylsulfonylethyl)-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 79841941) has the molecular formula C12H21N5O3S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-methyl-N-(2-methylsulfonylethyl)-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-methyl-N-(2-methylsulfonylethyl)-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 79841941 |
| Molecular Formula | C12H21N5O3S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-methyl-N-(2-methylsulfonylethyl)-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CN(CCS(C)(=O)=O)C(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C12H21N5O3S/c1-16(7-8-21(2,19)20)12(18)11-9-17(15-14-11)10-3-5-13-6-4-10/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | XQNQIWXEWYMNDX-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |