C20H31N8O3+ — CID 172795677
[2-[[1-hydrazinyl-1-oxo-6-[(1-phenyltriazole-4-carbonyl)amino]hexan-2-yl]amino]-2-oxoethyl]-trimethylazanium (PubChem CID 172795677) has the molecular formula C20H31N8O3+ and a molecular weight of 431.52 g/mol. Its IUPAC name is [2-[[1-hydrazinyl-1-oxo-6-[(1-phenyltriazole-4-carbonyl)amino]hexan-2-yl]amino]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[[1-hydrazinyl-1-oxo-6-[(1-phenyltriazole-4-carbonyl)amino]hexan-2-yl]amino]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 172795677 |
| Molecular Formula | C20H31N8O3+ |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | [2-[[1-hydrazinyl-1-oxo-6-[(1-phenyltriazole-4-carbonyl)amino]hexan-2-yl]amino]-2-oxoethyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(=O)NC(CCCCNC(=O)c1cn(-c2ccccc2)nn1)C(=O)NN |
| InChI | InChI=1S/C20H30N8O3/c1-28(2,3)14-18(29)23-16(20(31)24-21)11-7-8-12-22-19(30)17-13-27(26-25-17)15-9-5-4-6-10-15/h4-6,9-10,13,16H,7-8,11-12,14H2,1-3H3,(H4-,21,22,23,24,25,26,29,30,31)/p+1 |
| InChIKey | QEAHGWSNVZYQFN-UHFFFAOYSA-O |
| XLogP | -0.65 |
| TPSA | 144.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|