C16H12Cl2N2O3S2 — CID 26585972
3,6-dichloro-N-[(4-sulfamoylphenyl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 26585972) has the molecular formula C16H12Cl2N2O3S2 and a molecular weight of 415.32 g/mol. Its IUPAC name is 3,6-dichloro-N-[(4-sulfamoylphenyl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(4-sulfamoylphenyl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 26585972 |
| Molecular Formula | C16H12Cl2N2O3S2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | 3,6-dichloro-N-[(4-sulfamoylphenyl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2sc3cc(Cl)ccc3c2Cl)cc1 |
| InChI | InChI=1S/C16H12Cl2N2O3S2/c17-10-3-6-12-13(7-10)24-15(14(12)18)16(21)20-8-9-1-4-11(5-2-9)25(19,22)23/h1-7H,8H2,(H,20,21)(H2,19,22,23) |
| InChIKey | JPCMIEPLJKYXHA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |