C15H17Cl2NO2S — CID 103919460
3,6-dichloro-N-(6-hydroxyhexyl)-1-benzothiophene-2-carboxamide (PubChem CID 103919460) has the molecular formula C15H17Cl2NO2S and a molecular weight of 346.28 g/mol. Its IUPAC name is 3,6-dichloro-N-(6-hydroxyhexyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(6-hydroxyhexyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 103919460 |
| Molecular Formula | C15H17Cl2NO2S |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3,6-dichloro-N-(6-hydroxyhexyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCCCCO)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C15H17Cl2NO2S/c16-10-5-6-11-12(9-10)21-14(13(11)17)15(20)18-7-3-1-2-4-8-19/h5-6,9,19H,1-4,7-8H2,(H,18,20) |
| InChIKey | MLAGQKODJNRMCA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|