C16H17ClN2O3S — CID 110293759
2-chloro-N-[3-(4-sulfamoylphenyl)propyl]benzamide (PubChem CID 110293759) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 2-chloro-N-[3-(4-sulfamoylphenyl)propyl]benzamide.
| Compound Name | 2-chloro-N-[3-(4-sulfamoylphenyl)propyl]benzamide |
|---|---|
| PubChem CID | 110293759 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-chloro-N-[3-(4-sulfamoylphenyl)propyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CCCNC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O3S/c17-15-6-2-1-5-14(15)16(20)19-11-3-4-12-7-9-13(10-8-12)23(18,21)22/h1-2,5-10H,3-4,11H2,(H,19,20)(H2,18,21,22) |
| InChIKey | SUSOXEHECJQUMR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|