About methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate
methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate (PubChem CID 112794771) has the molecular formula C14H12Cl3NO3S
and a molecular weight of 380.68 g/mol. Its IUPAC name is methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate.
Molecular Properties
| Compound Name | methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate |
| PubChem CID | 112794771 |
| Molecular Formula | C14H12Cl3NO3S |
| Molecular Weight | 380.68 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1sc2cc(Cl)cc(Cl)c2c1Cl |
| InChI | InChI=1S/C14H12Cl3NO3S/c1-21-10(19)3-2-4-18-14(20)13-12(17)11-8(16)5-7(15)6-9(11)22-13/h5-6H,2-4H2,1H3,(H,18,20) |
| InChIKey | MBFNAUOLKWNAFP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.68 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate?
The IUPAC name of methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate (CID 112794771) is methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate.
What is the SMILES notation for methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate?
The canonical SMILES for methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate is COC(=O)CCCNC(=O)c1sc2cc(Cl)cc(Cl)c2c1Cl.
What is the InChIKey of methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate?
The InChIKey is MBFNAUOLKWNAFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl3NO3S/c1-21-10(19)3-2-4-18-14(20)13-12(17)11-8(16)5-7(15)6-9(11)22-13/h5-6H,2-4H2,1H3,(H,18,20).
What are the key properties of methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate?
methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate has a molecular weight of 380.68 g/mol, XLogP of 4.54, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(3,4,6-trichloro-1-benzothiophene-2-carbonyl)amino]butanoate is sourced from PubChem (CID 112794771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).