C11H7Cl3O2S — CID 132590861
ethyl 3,4,6-trichloro-1-benzothiophene-2-carboxylate (PubChem CID 132590861) has the molecular formula C11H7Cl3O2S and a molecular weight of 309.60 g/mol. Its IUPAC name is ethyl 3,4,6-trichloro-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 3,4,6-trichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 132590861 |
| Molecular Formula | C11H7Cl3O2S |
| Molecular Weight | 309.60 g/mol |
| Exact Mass | 307.92 |
| IUPAC Name | ethyl 3,4,6-trichloro-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2cc(Cl)cc(Cl)c2c1Cl |
| InChI | InChI=1S/C11H7Cl3O2S/c1-2-16-11(15)10-9(14)8-6(13)3-5(12)4-7(8)17-10/h3-4H,2H2,1H3 |
| InChIKey | WLFBRBXQGAOZAA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |