About isoquinoline;2-(oxan-2-yloxy)oxane
isoquinoline;2-(oxan-2-yloxy)oxane (PubChem CID 174581764) has the molecular formula C19H25NO3
and a molecular weight of 315.41 g/mol. Its IUPAC name is isoquinoline;2-(oxan-2-yloxy)oxane.
Molecular Properties
| Compound Name | isoquinoline;2-(oxan-2-yloxy)oxane |
| PubChem CID | 174581764 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | isoquinoline;2-(oxan-2-yloxy)oxane |
| SMILES | C1CCC(OC2CCCCO2)OC1.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C10H18O3.C9H7N/c1-3-7-11-9(5-1)13-10-6-2-4-8-12-10;1-2-4-9-7-10-6-5-8(9)3-1/h9-10H,1-8H2;1-7H |
| InChIKey | OMTINATTXDFJMI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze isoquinoline;2-(oxan-2-yloxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinoline;2-(oxan-2-yloxy)oxane?
The IUPAC name of isoquinoline;2-(oxan-2-yloxy)oxane (CID 174581764) is isoquinoline;2-(oxan-2-yloxy)oxane.
What is the SMILES notation for isoquinoline;2-(oxan-2-yloxy)oxane?
The canonical SMILES for isoquinoline;2-(oxan-2-yloxy)oxane is C1CCC(OC2CCCCO2)OC1.c1ccc2cnccc2c1.
What is the InChIKey of isoquinoline;2-(oxan-2-yloxy)oxane?
The InChIKey is OMTINATTXDFJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3.C9H7N/c1-3-7-11-9(5-1)13-10-6-2-4-8-12-10;1-2-4-9-7-10-6-5-8(9)3-1/h9-10H,1-8H2;1-7H.
What are the key properties of isoquinoline;2-(oxan-2-yloxy)oxane?
isoquinoline;2-(oxan-2-yloxy)oxane has a molecular weight of 315.41 g/mol, XLogP of 4.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline;2-(oxan-2-yloxy)oxane is sourced from PubChem (CID 174581764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).