C10H11NO3 — CID 59060293
amino 3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 59060293) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is amino 3,4-dihydro-2H-chromene-2-carboxylate.
| Compound Name | amino 3,4-dihydro-2H-chromene-2-carboxylate |
|---|---|
| PubChem CID | 59060293 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | amino 3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | NOC(=O)C1CCc2ccccc2O1 |
| InChI | InChI=1S/C10H11NO3/c11-14-10(12)9-6-5-7-3-1-2-4-8(7)13-9/h1-4,9H,5-6,11H2 |
| InChIKey | FHXIFYPEWJNGTB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|