C10H12N2O2 — CID 91352919
3,4-dihydro-2H-chromen-2-ylurea (PubChem CID 91352919) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-2-ylurea.
| Compound Name | 3,4-dihydro-2H-chromen-2-ylurea |
|---|---|
| PubChem CID | 91352919 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3,4-dihydro-2H-chromen-2-ylurea |
| SMILES | NC(=O)NC1CCc2ccccc2O1 |
| InChI | InChI=1S/C10H12N2O2/c11-10(13)12-9-6-5-7-3-1-2-4-8(7)14-9/h1-4,9H,5-6H2,(H3,11,12,13) |
| InChIKey | DMPOIHVLLDNSQI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |