C11H13NO3 — CID 19815598
N-hydroxy-N-methyl-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 19815598) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-hydroxy-N-methyl-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | N-hydroxy-N-methyl-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 19815598 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N-hydroxy-N-methyl-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | CN(O)C(=O)C1CCc2ccccc2O1 |
| InChI | InChI=1S/C11H13NO3/c1-12(14)11(13)10-7-6-8-4-2-3-5-9(8)15-10/h2-5,10,14H,6-7H2,1H3 |
| InChIKey | VBOMABTWBATCJL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|