About N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide
N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 91793841) has the molecular formula C17H18N2O2S
and a molecular weight of 314.41 g/mol. Its IUPAC name is N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide |
| PubChem CID | 91793841 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | O=C(C1CCc2ccccc2O1)N(Cc1nccs1)C1CC1 |
| InChI | InChI=1S/C17H18N2O2S/c20-17(15-8-5-12-3-1-2-4-14(12)21-15)19(13-6-7-13)11-16-18-9-10-22-16/h1-4,9-10,13,15H,5-8,11H2 |
| InChIKey | KMJOIQLQOCMPTI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide?
The IUPAC name of N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide (CID 91793841) is N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide.
What is the SMILES notation for N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide?
The canonical SMILES for N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide is O=C(C1CCc2ccccc2O1)N(Cc1nccs1)C1CC1.
What is the InChIKey of N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide?
The InChIKey is KMJOIQLQOCMPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O2S/c20-17(15-8-5-12-3-1-2-4-14(12)21-15)19(13-6-7-13)11-16-18-9-10-22-16/h1-4,9-10,13,15H,5-8,11H2.
What are the key properties of N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide?
N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide has a molecular weight of 314.41 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)-3,4-dihydro-2H-chromene-2-carboxamide is sourced from PubChem (CID 91793841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).