C15H14O2S — CID 100929300
2-(benzenesulfinyl)-3,4-dihydro-2H-chromene (PubChem CID 100929300) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-3,4-dihydro-2H-chromene.
| Compound Name | 2-(benzenesulfinyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 100929300 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-(benzenesulfinyl)-3,4-dihydro-2H-chromene |
| SMILES | O=S(c1ccccc1)C1CCc2ccccc2O1 |
| InChI | InChI=1S/C15H14O2S/c16-18(13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)17-15/h1-9,15H,10-11H2 |
| InChIKey | ZFIPAVOKYWOXQS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |