C16H16OS — CID 132573868
2-(benzenesulfinyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 132573868) has the molecular formula C16H16OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(benzenesulfinyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 132573868 |
| Molecular Formula | C16H16OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-(benzenesulfinyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=S(c1ccccc1)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H16OS/c17-18(15-8-2-1-3-9-15)16-11-10-13-6-4-5-7-14(13)12-16/h1-9,16H,10-12H2 |
| InChIKey | SNSAXOZYVXENHM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |