C14H20O2S — CID 101030165
trans-(1R,2R)-2-(benzenesulfinyl)cyclooctan-1-ol (PubChem CID 101030165) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is trans-(1R,2R)-2-(benzenesulfinyl)cyclooctan-1-ol.
| Compound Name | trans-(1R,2R)-2-(benzenesulfinyl)cyclooctan-1-ol |
|---|---|
| PubChem CID | 101030165 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | trans-(1R,2R)-2-(benzenesulfinyl)cyclooctan-1-ol |
| SMILES | O=S(c1ccccc1)[C@@H]1CCCCCC[C@H]1O |
| InChI | InChI=1S/C14H20O2S/c15-13-10-6-1-2-7-11-14(13)17(16)12-8-4-3-5-9-12/h3-5,8-9,13-15H,1-2,6-7,10-11H2/t13-,14-,17?/m1/s1 |
| InChIKey | IFPBVBCTIQFPTD-LJNCCCJHSA-N |
| XLogP | 2.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |