C10H14N+ — CID 40572503
[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]azanium (PubChem CID 40572503) has the molecular formula C10H14N+ and a molecular weight of 148.23 g/mol. Its IUPAC name is [(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]azanium.
| Compound Name | [(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]azanium |
|---|---|
| PubChem CID | 40572503 |
| Molecular Formula | C10H14N+ |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | [(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]azanium |
| SMILES | [NH3+][C@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C10H13N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7,11H2/p+1/t10-/m0/s1 |
| InChIKey | LCGFVWKNXLRFIF-JTQLQIEISA-O |
| XLogP | 0.79 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |