C11H14O3S — CID 124600614
[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl] methanesulfonate (PubChem CID 124600614) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is [(2S)-1,2,3,4-tetrahydronaphthalen-2-yl] methanesulfonate.
| Compound Name | [(2S)-1,2,3,4-tetrahydronaphthalen-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 124600614 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | [(2S)-1,2,3,4-tetrahydronaphthalen-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C11H14O3S/c1-15(12,13)14-11-7-6-9-4-2-3-5-10(9)8-11/h2-5,11H,6-8H2,1H3/t11-/m0/s1 |
| InChIKey | GCHSTPNWXULIPY-NSHDSACASA-N |
| XLogP | 1.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|