C12H16O3S — CID 88682466
(1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl) methanesulfonate (PubChem CID 88682466) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is (1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl) methanesulfonate.
| Compound Name | (1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl) methanesulfonate |
|---|---|
| PubChem CID | 88682466 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl) methanesulfonate |
| SMILES | CC1c2ccccc2CCC1OS(C)(=O)=O |
| InChI | InChI=1S/C12H16O3S/c1-9-11-6-4-3-5-10(11)7-8-12(9)15-16(2,13)14/h3-6,9,12H,7-8H2,1-2H3 |
| InChIKey | XSHQXUDWBDAMML-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|