C13H16O4S — CID 58286683
[(1R,2S)-1-(2-oxopropyl)-2,3-dihydro-1H-inden-2-yl] methanesulfonate (PubChem CID 58286683) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is [(1R,2S)-1-(2-oxopropyl)-2,3-dihydro-1H-inden-2-yl] methanesulfonate.
| Compound Name | [(1R,2S)-1-(2-oxopropyl)-2,3-dihydro-1H-inden-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 58286683 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | [(1R,2S)-1-(2-oxopropyl)-2,3-dihydro-1H-inden-2-yl] methanesulfonate |
| SMILES | CC(=O)C[C@@H]1c2ccccc2C[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C13H16O4S/c1-9(14)7-12-11-6-4-3-5-10(11)8-13(12)17-18(2,15)16/h3-6,12-13H,7-8H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | COYSLSRGNLHBPG-OLZOCXBDSA-N |
| XLogP | 1.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|