C18H22O4 — CID 11449504
[(8Z)-6-acetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-11-yl] acetate (PubChem CID 11449504) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(8Z)-6-acetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-11-yl] acetate.
| Compound Name | [(8Z)-6-acetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-11-yl] acetate |
|---|---|
| PubChem CID | 11449504 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(8Z)-6-acetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-11-yl] acetate |
| SMILES | CC(=O)OC1C/C=C\CC(OC(C)=O)Cc2ccccc2C1 |
| InChI | InChI=1S/C18H22O4/c1-13(19)21-17-9-5-6-10-18(22-14(2)20)12-16-8-4-3-7-15(16)11-17/h3-8,17-18H,9-12H2,1-2H3/b6-5- |
| InChIKey | GRQSHJCIOXYCEQ-WAYWQWQTSA-N |
| XLogP | 2.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|