benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate

C19H19NO4 — CID 70085551

IUPACbenzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate
SMILESCC(=O)O[C@H]1Cc2ccccc2N(C(=O)OCc2ccccc2)C1
InChIInChI=1S/C19H19NO4/c1-14(21)24-17-11-16-9-5-6-10-18(16)20(12-17)19(22)23-13-15-7-3-2-4-8-15/h2-10,17H,11-13H2,1H3/t17-/m0/s1
InChIKeyUAGSMPSHJZQJKY-KRWDZBQOSA-N
MW325.36 g/mol
LogP3.32
Rot. Bonds3

About benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate

benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 70085551) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate.

Molecular Properties

Compound Namebenzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate
PubChem CID70085551
Molecular FormulaC19H19NO4
Molecular Weight325.36 g/mol
Exact Mass325.13
IUPAC Namebenzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate
SMILESCC(=O)O[C@H]1Cc2ccccc2N(C(=O)OCc2ccccc2)C1
InChIInChI=1S/C19H19NO4/c1-14(21)24-17-11-16-9-5-6-10-18(16)20(12-17)19(22)23-13-15-7-3-2-4-8-15/h2-10,17H,11-13H2,1H3/t17-/m0/s1
InChIKeyUAGSMPSHJZQJKY-KRWDZBQOSA-N
XLogP3.32
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.36
LogP ≤ 53.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate?
The IUPAC name of benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate (CID 70085551) is benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate.
What is the SMILES notation for benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate?
The canonical SMILES for benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate is CC(=O)O[C@H]1Cc2ccccc2N(C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate?
The InChIKey is UAGSMPSHJZQJKY-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H19NO4/c1-14(21)24-17-11-16-9-5-6-10-18(16)20(12-17)19(22)23-13-15-7-3-2-4-8-15/h2-10,17H,11-13H2,1H3/t17-/m0/s1.
What are the key properties of benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate?
benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate has a molecular weight of 325.36 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3S)-3-acetyloxy-3,4-dihydro-2H-quinoline-1-carboxylate is sourced from PubChem (CID 70085551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).