C25H26N2O3 — CID 67254134
benzyl 3-[(2-amino-4-methylphenoxy)methyl]-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 67254134) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is benzyl 3-[(2-amino-4-methylphenoxy)methyl]-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | benzyl 3-[(2-amino-4-methylphenoxy)methyl]-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 67254134 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | benzyl 3-[(2-amino-4-methylphenoxy)methyl]-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | Cc1ccc(OCC2Cc3ccccc3N(C(=O)OCc3ccccc3)C2)c(N)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-18-11-12-24(22(26)13-18)29-17-20-14-21-9-5-6-10-23(21)27(15-20)25(28)30-16-19-7-3-2-4-8-19/h2-13,20H,14-17,26H2,1H3 |
| InChIKey | LZRDCBPCLLOIQK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|