C20H22N2O4 — CID 70086052
benzyl (3S)-3-(methoxymethylcarbamoyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 70086052) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is benzyl (3S)-3-(methoxymethylcarbamoyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | benzyl (3S)-3-(methoxymethylcarbamoyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 70086052 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | benzyl (3S)-3-(methoxymethylcarbamoyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | COCNC(=O)[C@H]1Cc2ccccc2N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C20H22N2O4/c1-25-14-21-19(23)17-11-16-9-5-6-10-18(16)22(12-17)20(24)26-13-15-7-3-2-4-8-15/h2-10,17H,11-14H2,1H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | YJISZZVJLMBRGD-KRWDZBQOSA-N |
| XLogP | 2.72 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|