C15H18O2 — CID 174350360
2,3-dihydro-1H-inden-2-yl (E)-2-ethylbut-2-enoate (PubChem CID 174350360) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl (E)-2-ethylbut-2-enoate.
| Compound Name | 2,3-dihydro-1H-inden-2-yl (E)-2-ethylbut-2-enoate |
|---|---|
| PubChem CID | 174350360 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl (E)-2-ethylbut-2-enoate |
| SMILES | C/C=C(\CC)C(=O)OC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H18O2/c1-3-11(4-2)15(16)17-14-9-12-7-5-6-8-13(12)10-14/h3,5-8,14H,4,9-10H2,1-2H3/b11-3+ |
| InChIKey | SWXDIGCNRAMPSE-QDEBKDIKSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|