C22H32O3S — CID 143324852
(Z)-but-2-ene;2,3-dihydro-1H-inden-2-yl 4-oxopentanoate;3-methylthietane (PubChem CID 143324852) has the molecular formula C22H32O3S and a molecular weight of 376.56 g/mol. Its IUPAC name is (Z)-but-2-ene;2,3-dihydro-1H-inden-2-yl 4-oxopentanoate;3-methylthietane.
| Compound Name | (Z)-but-2-ene;2,3-dihydro-1H-inden-2-yl 4-oxopentanoate;3-methylthietane |
|---|---|
| PubChem CID | 143324852 |
| Molecular Formula | C22H32O3S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (Z)-but-2-ene;2,3-dihydro-1H-inden-2-yl 4-oxopentanoate;3-methylthietane |
| SMILES | C/C=C\C.CC(=O)CCC(=O)OC1Cc2ccccc2C1.CC1CSC1 |
| InChI | InChI=1S/C14H16O3.C4H8S.C4H8/c1-10(15)6-7-14(16)17-13-8-11-4-2-3-5-12(11)9-13;1-4-2-5-3-4;1-3-4-2/h2-5,13H,6-9H2,1H3;4H,2-3H2,1H3;3-4H,1-2H3/b;;4-3- |
| InChIKey | RJPOWGBWGZJZRX-PWIAZYAQSA-N |
| XLogP | 5.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|