C13H15BrO2 — CID 139754475
[(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-yl] butanoate (PubChem CID 139754475) has the molecular formula C13H15BrO2 and a molecular weight of 283.17 g/mol. Its IUPAC name is [(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-yl] butanoate.
| Compound Name | [(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-yl] butanoate |
|---|---|
| PubChem CID | 139754475 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | [(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1c2ccccc2C[C@H]1Br |
| InChI | InChI=1S/C13H15BrO2/c1-2-5-12(15)16-13-10-7-4-3-6-9(10)8-11(13)14/h3-4,6-7,11,13H,2,5,8H2,1H3/t11-,13-/m1/s1 |
| InChIKey | HJJVIJQLOYVFLS-DGCLKSJQSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|