About [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate
[2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate (PubChem CID 144517198) has the molecular formula C23H27NO3
and a molecular weight of 365.47 g/mol. Its IUPAC name is [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate.
Molecular Properties
| Compound Name | [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate |
| PubChem CID | 144517198 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)OC1c2ccccc2CC1Cc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-15(2)7-12-21(25)27-22-19(14-18-5-3-4-6-20(18)22)13-16-8-10-17(11-9-16)23(24)26/h3-6,8-11,15,19,22H,7,12-14H2,1-2H3,(H2,24,26) |
| InChIKey | MAZIXSSFKGIGDP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate?
The IUPAC name of [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate (CID 144517198) is [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate.
What is the SMILES notation for [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate?
The canonical SMILES for [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate is CC(C)CCC(=O)OC1c2ccccc2CC1Cc1ccc(C(N)=O)cc1.
What is the InChIKey of [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate?
The InChIKey is MAZIXSSFKGIGDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO3/c1-15(2)7-12-21(25)27-22-19(14-18-5-3-4-6-20(18)22)13-16-8-10-17(11-9-16)23(24)26/h3-6,8-11,15,19,22H,7,12-14H2,1-2H3,(H2,24,26).
What are the key properties of [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate?
[2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate has a molecular weight of 365.47 g/mol, XLogP of 4.22, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-carbamoylphenyl)methyl]-2,3-dihydro-1H-inden-1-yl] 4-methylpentanoate is sourced from PubChem (CID 144517198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).