About 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride
2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride (PubChem CID 78168897) has the molecular formula C20H26ClNO
and a molecular weight of 331.89 g/mol. Its IUPAC name is 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride.
Molecular Properties
| Compound Name | 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride |
| PubChem CID | 78168897 |
| Molecular Formula | C20H26ClNO |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride |
| SMILES | C[NH+](C)CCOC1c2ccccc2CC1Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H25NO.ClH/c1-21(2)12-13-22-20-18(14-16-8-4-3-5-9-16)15-17-10-6-7-11-19(17)20;/h3-11,18,20H,12-15H2,1-2H3;1H |
| InChIKey | WLVUMWRUEXFIKN-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride?
The IUPAC name of 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride (CID 78168897) is 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride.
What is the SMILES notation for 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride?
The canonical SMILES for 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride is C[NH+](C)CCOC1c2ccccc2CC1Cc1ccccc1.[Cl-].
What is the InChIKey of 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride?
The InChIKey is WLVUMWRUEXFIKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO.ClH/c1-21(2)12-13-22-20-18(14-16-8-4-3-5-9-16)15-17-10-6-7-11-19(17)20;/h3-11,18,20H,12-15H2,1-2H3;1H.
What are the key properties of 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride?
2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride has a molecular weight of 331.89 g/mol, XLogP of -0.69, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-benzyl-2,3-dihydro-1H-inden-1-yl)oxy]ethyl-dimethylazanium chloride is sourced from PubChem (CID 78168897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).