About [(1S,2R)-2-methoxycyclopropyl]methylbenzene
[(1S,2R)-2-methoxycyclopropyl]methylbenzene (PubChem CID 100914167) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is [(1S,2R)-2-methoxycyclopropyl]methylbenzene.
Molecular Properties
| Compound Name | [(1S,2R)-2-methoxycyclopropyl]methylbenzene |
| PubChem CID | 100914167 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | [(1S,2R)-2-methoxycyclopropyl]methylbenzene |
| SMILES | CO[C@@H]1C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C11H14O/c1-12-11-8-10(11)7-9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | XSWSOOIARFUHHY-WDEREUQCSA-N |
| XLogP | 2.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S,2R)-2-methoxycyclopropyl]methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-methoxycyclopropyl]methylbenzene?
The IUPAC name of [(1S,2R)-2-methoxycyclopropyl]methylbenzene (CID 100914167) is [(1S,2R)-2-methoxycyclopropyl]methylbenzene.
What is the SMILES notation for [(1S,2R)-2-methoxycyclopropyl]methylbenzene?
The canonical SMILES for [(1S,2R)-2-methoxycyclopropyl]methylbenzene is CO[C@@H]1C[C@@H]1Cc1ccccc1.
What is the InChIKey of [(1S,2R)-2-methoxycyclopropyl]methylbenzene?
The InChIKey is XSWSOOIARFUHHY-WDEREUQCSA-N. The full InChI is InChI=1S/C11H14O/c1-12-11-8-10(11)7-9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3/t10-,11+/m0/s1.
What are the key properties of [(1S,2R)-2-methoxycyclopropyl]methylbenzene?
[(1S,2R)-2-methoxycyclopropyl]methylbenzene has a molecular weight of 162.23 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-methoxycyclopropyl]methylbenzene is sourced from PubChem (CID 100914167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).