About 3-benzyl-2-methoxyoxane
3-benzyl-2-methoxyoxane (PubChem CID 13382528) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-benzyl-2-methoxyoxane.
Molecular Properties
| Compound Name | 3-benzyl-2-methoxyoxane |
| PubChem CID | 13382528 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-benzyl-2-methoxyoxane |
| SMILES | COC1OCCCC1Cc1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-14-13-12(8-5-9-15-13)10-11-6-3-2-4-7-11/h2-4,6-7,12-13H,5,8-10H2,1H3 |
| InChIKey | ICSOMFULASAUCR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-2-methoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2-methoxyoxane?
The IUPAC name of 3-benzyl-2-methoxyoxane (CID 13382528) is 3-benzyl-2-methoxyoxane.
What is the SMILES notation for 3-benzyl-2-methoxyoxane?
The canonical SMILES for 3-benzyl-2-methoxyoxane is COC1OCCCC1Cc1ccccc1.
What is the InChIKey of 3-benzyl-2-methoxyoxane?
The InChIKey is ICSOMFULASAUCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-14-13-12(8-5-9-15-13)10-11-6-3-2-4-7-11/h2-4,6-7,12-13H,5,8-10H2,1H3.
What are the key properties of 3-benzyl-2-methoxyoxane?
3-benzyl-2-methoxyoxane has a molecular weight of 206.29 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2-methoxyoxane is sourced from PubChem (CID 13382528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).