About 2-benzyloxepane
2-benzyloxepane (PubChem CID 14272917) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-benzyloxepane.
Molecular Properties
| Compound Name | 2-benzyloxepane |
| PubChem CID | 14272917 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2-benzyloxepane |
| SMILES | c1ccc(CC2CCCCCO2)cc1 |
| InChI | InChI=1S/C13H18O/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-14-13/h1,3-4,7-8,13H,2,5-6,9-11H2 |
| InChIKey | BGZMSEBJEVWASP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-benzyloxepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyloxepane?
The IUPAC name of 2-benzyloxepane (CID 14272917) is 2-benzyloxepane.
What is the SMILES notation for 2-benzyloxepane?
The canonical SMILES for 2-benzyloxepane is c1ccc(CC2CCCCCO2)cc1.
What is the InChIKey of 2-benzyloxepane?
The InChIKey is BGZMSEBJEVWASP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-14-13/h1,3-4,7-8,13H,2,5-6,9-11H2.
What are the key properties of 2-benzyloxepane?
2-benzyloxepane has a molecular weight of 190.29 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyloxepane is sourced from PubChem (CID 14272917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).