C28H32O5 — CID 10671161
(1S,2R,3S,4S,5S)-5-methoxy-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol (PubChem CID 10671161) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is (1S,2R,3S,4S,5S)-5-methoxy-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1S,2R,3S,4S,5S)-5-methoxy-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10671161 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (1S,2R,3S,4S,5S)-5-methoxy-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol |
| SMILES | COC1C[C@H](O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H32O5/c1-30-25-17-24(29)26(31-18-21-11-5-2-6-12-21)28(33-20-23-15-9-4-10-16-23)27(25)32-19-22-13-7-3-8-14-22/h2-16,24-29H,17-20H2,1H3/t24-,25?,26+,27-,28-/m0/s1 |
| InChIKey | UQUKKZWAUQVYTP-IRVMZULESA-N |
| XLogP | 4.52 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |